C18H14N4O2S2 — CID 2253271
4-[[(E)-2-cyano-2-(4-phenyl-1,3-thiazol-2-yl)ethenyl]amino]benzenesulfonamide (PubChem CID 2253271) has the molecular formula C18H14N4O2S2 and a molecular weight of 382.47 g/mol. Its IUPAC name is 4-[[(E)-2-cyano-2-(4-phenyl-1,3-thiazol-2-yl)ethenyl]amino]benzenesulfonamide.
| Compound Name | 4-[[(E)-2-cyano-2-(4-phenyl-1,3-thiazol-2-yl)ethenyl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 2253271 |
| Molecular Formula | C18H14N4O2S2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | 4-[[(E)-2-cyano-2-(4-phenyl-1,3-thiazol-2-yl)ethenyl]amino]benzenesulfonamide |
| SMILES | N#C/C(=C\Nc1ccc(S(N)(=O)=O)cc1)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C18H14N4O2S2/c19-10-14(11-21-15-6-8-16(9-7-15)26(20,23)24)18-22-17(12-25-18)13-4-2-1-3-5-13/h1-9,11-12,21H,(H2,20,23,24)/b14-11+ |
| InChIKey | JXPXUSZPOJGBFB-SDNWHVSQSA-N |
| XLogP | 3.43 |
| TPSA | 108.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|