C24H15FN4O2S — CID 51045231
(E)-3-(4-fluoro-3-nitroanilino)-2-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 51045231) has the molecular formula C24H15FN4O2S and a molecular weight of 442.48 g/mol. Its IUPAC name is (E)-3-(4-fluoro-3-nitroanilino)-2-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | (E)-3-(4-fluoro-3-nitroanilino)-2-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 51045231 |
| Molecular Formula | C24H15FN4O2S |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | (E)-3-(4-fluoro-3-nitroanilino)-2-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | N#C/C(=C\Nc1ccc(F)c([N+](=O)[O-])c1)c1nc(-c2ccc(-c3ccccc3)cc2)cs1 |
| InChI | InChI=1S/C24H15FN4O2S/c25-21-11-10-20(12-23(21)29(30)31)27-14-19(13-26)24-28-22(15-32-24)18-8-6-17(7-9-18)16-4-2-1-3-5-16/h1-12,14-15,27H/b19-14+ |
| InChIKey | ITEIJEMUSDUXNG-XMHGGMMESA-N |
| XLogP | 6.50 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|