C19H13FN4O3S — CID 3811877
3-(4-fluoro-2-nitroanilino)-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 3811877) has the molecular formula C19H13FN4O3S and a molecular weight of 396.40 g/mol. Its IUPAC name is 3-(4-fluoro-2-nitroanilino)-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | 3-(4-fluoro-2-nitroanilino)-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 3811877 |
| Molecular Formula | C19H13FN4O3S |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | 3-(4-fluoro-2-nitroanilino)-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | COc1ccc(-c2csc(C(C#N)=CNc3ccc(F)cc3[N+](=O)[O-])n2)cc1 |
| InChI | InChI=1S/C19H13FN4O3S/c1-27-15-5-2-12(3-6-15)17-11-28-19(23-17)13(9-21)10-22-16-7-4-14(20)8-18(16)24(25)26/h2-8,10-11,22H,1H3 |
| InChIKey | BQIKJILJERHAJA-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 101.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|