C20H16N4O4S — CID 6149354
(E)-2-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-(2-nitroanilino)prop-2-enenitrile (PubChem CID 6149354) has the molecular formula C20H16N4O4S and a molecular weight of 408.44 g/mol. Its IUPAC name is (E)-2-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-(2-nitroanilino)prop-2-enenitrile.
| Compound Name | (E)-2-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-(2-nitroanilino)prop-2-enenitrile |
|---|---|
| PubChem CID | 6149354 |
| Molecular Formula | C20H16N4O4S |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | (E)-2-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-(2-nitroanilino)prop-2-enenitrile |
| SMILES | COc1ccc(-c2csc(/C(C#N)=C/Nc3ccccc3[N+](=O)[O-])n2)cc1OC |
| InChI | InChI=1S/C20H16N4O4S/c1-27-18-8-7-13(9-19(18)28-2)16-12-29-20(23-16)14(10-21)11-22-15-5-3-4-6-17(15)24(25)26/h3-9,11-12,22H,1-2H3/b14-11+ |
| InChIKey | RKTJXBHRQJKQTF-SDNWHVSQSA-N |
| XLogP | 4.71 |
| TPSA | 110.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|