C20H16N4O5S — CID 3704605
2-[4-(4-hydroxy-3-methoxyphenyl)-1,3-thiazol-2-yl]-3-(2-methoxy-4-nitroanilino)prop-2-enenitrile (PubChem CID 3704605) has the molecular formula C20H16N4O5S and a molecular weight of 424.44 g/mol. Its IUPAC name is 2-[4-(4-hydroxy-3-methoxyphenyl)-1,3-thiazol-2-yl]-3-(2-methoxy-4-nitroanilino)prop-2-enenitrile.
| Compound Name | 2-[4-(4-hydroxy-3-methoxyphenyl)-1,3-thiazol-2-yl]-3-(2-methoxy-4-nitroanilino)prop-2-enenitrile |
|---|---|
| PubChem CID | 3704605 |
| Molecular Formula | C20H16N4O5S |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | 2-[4-(4-hydroxy-3-methoxyphenyl)-1,3-thiazol-2-yl]-3-(2-methoxy-4-nitroanilino)prop-2-enenitrile |
| SMILES | COc1cc(-c2csc(C(C#N)=CNc3ccc([N+](=O)[O-])cc3OC)n2)ccc1O |
| InChI | InChI=1S/C20H16N4O5S/c1-28-18-8-14(24(26)27)4-5-15(18)22-10-13(9-21)20-23-16(11-30-20)12-3-6-17(25)19(7-12)29-2/h3-8,10-11,22,25H,1-2H3 |
| InChIKey | GXUJZQVIOZAOIQ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 130.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|