C20H14N4O4S — CID 4577653
2-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-3-(2-methyl-4-nitroanilino)prop-2-enenitrile (PubChem CID 4577653) has the molecular formula C20H14N4O4S and a molecular weight of 406.42 g/mol. Its IUPAC name is 2-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-3-(2-methyl-4-nitroanilino)prop-2-enenitrile.
| Compound Name | 2-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-3-(2-methyl-4-nitroanilino)prop-2-enenitrile |
|---|---|
| PubChem CID | 4577653 |
| Molecular Formula | C20H14N4O4S |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | 2-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-3-(2-methyl-4-nitroanilino)prop-2-enenitrile |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC=C(C#N)c1nc(-c2ccc3c(c2)OCO3)cs1 |
| InChI | InChI=1S/C20H14N4O4S/c1-12-6-15(24(25)26)3-4-16(12)22-9-14(8-21)20-23-17(10-29-20)13-2-5-18-19(7-13)28-11-27-18/h2-7,9-10,22H,11H2,1H3 |
| InChIKey | KYHRRVQYOMFIOX-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 110.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|