C22H15N3O5S — CID 3467001
3-[(6-acetyl-1,3-benzodioxol-5-yl)amino]-2-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 3467001) has the molecular formula C22H15N3O5S and a molecular weight of 433.45 g/mol. Its IUPAC name is 3-[(6-acetyl-1,3-benzodioxol-5-yl)amino]-2-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | 3-[(6-acetyl-1,3-benzodioxol-5-yl)amino]-2-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 3467001 |
| Molecular Formula | C22H15N3O5S |
| Molecular Weight | 433.45 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | 3-[(6-acetyl-1,3-benzodioxol-5-yl)amino]-2-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | CC(=O)c1cc2c(cc1NC=C(C#N)c1nc(-c3ccc4c(c3)OCO4)cs1)OCO2 |
| InChI | InChI=1S/C22H15N3O5S/c1-12(26)15-5-20-21(30-11-29-20)6-16(15)24-8-14(7-23)22-25-17(9-31-22)13-2-3-18-19(4-13)28-10-27-18/h2-6,8-9,24H,10-11H2,1H3 |
| InChIKey | ZBDGZTUHTUEOJW-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 102.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.45 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|