C25H21N3O3S — CID 143044710
(E)-3-[4-(2-acetylcyclobutyl)anilino]-2-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 143044710) has the molecular formula C25H21N3O3S and a molecular weight of 443.53 g/mol. Its IUPAC name is (E)-3-[4-(2-acetylcyclobutyl)anilino]-2-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | (E)-3-[4-(2-acetylcyclobutyl)anilino]-2-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 143044710 |
| Molecular Formula | C25H21N3O3S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | (E)-3-[4-(2-acetylcyclobutyl)anilino]-2-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | CC(=O)C1CCC1c1ccc(N/C=C(\C#N)c2nc(-c3ccc4c(c3)OCO4)cs2)cc1 |
| InChI | InChI=1S/C25H21N3O3S/c1-15(29)20-7-8-21(20)16-2-5-19(6-3-16)27-12-18(11-26)25-28-22(13-32-25)17-4-9-23-24(10-17)31-14-30-23/h2-6,9-10,12-13,20-21,27H,7-8,14H2,1H3/b18-12+ |
| InChIKey | ITHFADFTSOVFKK-LDADJPATSA-N |
| XLogP | 5.60 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|