C20H11ClF3N3O2S — CID 4647880
2-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-3-[4-chloro-3-(trifluoromethyl)anilino]prop-2-enenitrile (PubChem CID 4647880) has the molecular formula C20H11ClF3N3O2S and a molecular weight of 449.84 g/mol. Its IUPAC name is 2-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-3-[4-chloro-3-(trifluoromethyl)anilino]prop-2-enenitrile.
| Compound Name | 2-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-3-[4-chloro-3-(trifluoromethyl)anilino]prop-2-enenitrile |
|---|---|
| PubChem CID | 4647880 |
| Molecular Formula | C20H11ClF3N3O2S |
| Molecular Weight | 449.84 g/mol |
| Exact Mass | 449.02 |
| IUPAC Name | 2-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-3-[4-chloro-3-(trifluoromethyl)anilino]prop-2-enenitrile |
| SMILES | N#CC(=CNc1ccc(Cl)c(C(F)(F)F)c1)c1nc(-c2ccc3c(c2)OCO3)cs1 |
| InChI | InChI=1S/C20H11ClF3N3O2S/c21-15-3-2-13(6-14(15)20(22,23)24)26-8-12(7-25)19-27-16(9-30-19)11-1-4-17-18(5-11)29-10-28-17/h1-6,8-9,26H,10H2 |
| InChIKey | VFYOZGNPSINGRK-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.84 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|