C19H9Cl3F3N3S — CID 3279116
3-[4-chloro-3-(trifluoromethyl)anilino]-2-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 3279116) has the molecular formula C19H9Cl3F3N3S and a molecular weight of 474.72 g/mol. Its IUPAC name is 3-[4-chloro-3-(trifluoromethyl)anilino]-2-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | 3-[4-chloro-3-(trifluoromethyl)anilino]-2-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 3279116 |
| Molecular Formula | C19H9Cl3F3N3S |
| Molecular Weight | 474.72 g/mol |
| Exact Mass | 472.95 |
| IUPAC Name | 3-[4-chloro-3-(trifluoromethyl)anilino]-2-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | N#CC(=CNc1ccc(Cl)c(C(F)(F)F)c1)c1nc(-c2ccc(Cl)cc2Cl)cs1 |
| InChI | InChI=1S/C19H9Cl3F3N3S/c20-11-1-3-13(16(22)5-11)17-9-29-18(28-17)10(7-26)8-27-12-2-4-15(21)14(6-12)19(23,24)25/h1-6,8-9,27H |
| InChIKey | ZPJPNASPXXMFBU-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.72 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|