C19H13Cl2N3OS — CID 98102638
(Z)-2-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-3-(4-methoxyanilino)prop-2-enenitrile (PubChem CID 98102638) has the molecular formula C19H13Cl2N3OS and a molecular weight of 402.31 g/mol. Its IUPAC name is (Z)-2-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-3-(4-methoxyanilino)prop-2-enenitrile.
| Compound Name | (Z)-2-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-3-(4-methoxyanilino)prop-2-enenitrile |
|---|---|
| PubChem CID | 98102638 |
| Molecular Formula | C19H13Cl2N3OS |
| Molecular Weight | 402.31 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | (Z)-2-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-3-(4-methoxyanilino)prop-2-enenitrile |
| SMILES | COc1ccc(N/C=C(/C#N)c2nc(-c3ccc(Cl)cc3Cl)cs2)cc1 |
| InChI | InChI=1S/C19H13Cl2N3OS/c1-25-15-5-3-14(4-6-15)23-10-12(9-22)19-24-18(11-26-19)16-7-2-13(20)8-17(16)21/h2-8,10-11,23H,1H3/b12-10- |
| InChIKey | YHVMLMPXYYXRPC-BENRWUELSA-N |
| XLogP | 6.10 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.31 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|