C21H18ClN3O3S — CID 3453185
2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-(3,4,5-trimethoxyanilino)prop-2-enenitrile (PubChem CID 3453185) has the molecular formula C21H18ClN3O3S and a molecular weight of 427.91 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-(3,4,5-trimethoxyanilino)prop-2-enenitrile.
| Compound Name | 2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-(3,4,5-trimethoxyanilino)prop-2-enenitrile |
|---|---|
| PubChem CID | 3453185 |
| Molecular Formula | C21H18ClN3O3S |
| Molecular Weight | 427.91 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | 2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-(3,4,5-trimethoxyanilino)prop-2-enenitrile |
| SMILES | COc1cc(NC=C(C#N)c2nc(-c3ccc(Cl)cc3)cs2)cc(OC)c1OC |
| InChI | InChI=1S/C21H18ClN3O3S/c1-26-18-8-16(9-19(27-2)20(18)28-3)24-11-14(10-23)21-25-17(12-29-21)13-4-6-15(22)7-5-13/h4-9,11-12,24H,1-3H3 |
| InChIKey | KOMLKXDFEIXYDU-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 76.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.91 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|