C23H21ClN2O3S — CID 110530315
(Z)-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-(3,5-dimethoxy-4-propoxyphenyl)prop-2-enenitrile (PubChem CID 110530315) has the molecular formula C23H21ClN2O3S and a molecular weight of 440.95 g/mol. Its IUPAC name is (Z)-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-(3,5-dimethoxy-4-propoxyphenyl)prop-2-enenitrile.
| Compound Name | (Z)-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-(3,5-dimethoxy-4-propoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 110530315 |
| Molecular Formula | C23H21ClN2O3S |
| Molecular Weight | 440.95 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | (Z)-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-(3,5-dimethoxy-4-propoxyphenyl)prop-2-enenitrile |
| SMILES | CCCOc1c(OC)cc(/C=C(/C#N)c2nc(-c3ccc(Cl)cc3)cs2)cc1OC |
| InChI | InChI=1S/C23H21ClN2O3S/c1-4-9-29-22-20(27-2)11-15(12-21(22)28-3)10-17(13-25)23-26-19(14-30-23)16-5-7-18(24)8-6-16/h5-8,10-12,14H,4,9H2,1-3H3/b17-10- |
| InChIKey | OBOJJSVGWSBXDP-YVLHZVERSA-N |
| XLogP | 6.33 |
| TPSA | 64.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.95 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|