C21H16Cl2N2OS — CID 110531530
(Z)-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-(3-chloro-4-propoxyphenyl)prop-2-enenitrile (PubChem CID 110531530) has the molecular formula C21H16Cl2N2OS and a molecular weight of 415.35 g/mol. Its IUPAC name is (Z)-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-(3-chloro-4-propoxyphenyl)prop-2-enenitrile.
| Compound Name | (Z)-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-(3-chloro-4-propoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 110531530 |
| Molecular Formula | C21H16Cl2N2OS |
| Molecular Weight | 415.35 g/mol |
| Exact Mass | 414.04 |
| IUPAC Name | (Z)-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-(3-chloro-4-propoxyphenyl)prop-2-enenitrile |
| SMILES | CCCOc1ccc(/C=C(/C#N)c2nc(-c3ccc(Cl)cc3)cs2)cc1Cl |
| InChI | InChI=1S/C21H16Cl2N2OS/c1-2-9-26-20-8-3-14(11-18(20)23)10-16(12-24)21-25-19(13-27-21)15-4-6-17(22)7-5-15/h3-8,10-11,13H,2,9H2,1H3/b16-10- |
| InChIKey | ZAVFNWZEKKTNRW-YBEGLDIGSA-N |
| XLogP | 6.97 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.35 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|