C22H19ClN2S — CID 18809307
(E)-3-(4-tert-butylphenyl)-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 18809307) has the molecular formula C22H19ClN2S and a molecular weight of 378.93 g/mol. Its IUPAC name is (E)-3-(4-tert-butylphenyl)-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | (E)-3-(4-tert-butylphenyl)-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 18809307 |
| Molecular Formula | C22H19ClN2S |
| Molecular Weight | 378.93 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | (E)-3-(4-tert-butylphenyl)-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | CC(C)(C)c1ccc(/C=C(\C#N)c2nc(-c3ccc(Cl)cc3)cs2)cc1 |
| InChI | InChI=1S/C22H19ClN2S/c1-22(2,3)18-8-4-15(5-9-18)12-17(13-24)21-25-20(14-26-21)16-6-10-19(23)11-7-16/h4-12,14H,1-3H3/b17-12+ |
| InChIKey | MLTBZSRHZGESQY-SFQUDFHCSA-N |
| XLogP | 6.83 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.93 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|