C20H16ClN3O2S2 — CID 25216138
4-[2-[(Z)-2-(4-chlorophenyl)-1-cyanoethenyl]-1,3-thiazol-4-yl]-N,N-dimethylbenzenesulfonamide (PubChem CID 25216138) has the molecular formula C20H16ClN3O2S2 and a molecular weight of 429.95 g/mol. Its IUPAC name is 4-[2-[(Z)-2-(4-chlorophenyl)-1-cyanoethenyl]-1,3-thiazol-4-yl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-[2-[(Z)-2-(4-chlorophenyl)-1-cyanoethenyl]-1,3-thiazol-4-yl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 25216138 |
| Molecular Formula | C20H16ClN3O2S2 |
| Molecular Weight | 429.95 g/mol |
| Exact Mass | 429.04 |
| IUPAC Name | 4-[2-[(Z)-2-(4-chlorophenyl)-1-cyanoethenyl]-1,3-thiazol-4-yl]-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(-c2csc(/C(C#N)=C\c3ccc(Cl)cc3)n2)cc1 |
| InChI | InChI=1S/C20H16ClN3O2S2/c1-24(2)28(25,26)18-9-5-15(6-10-18)19-13-27-20(23-19)16(12-22)11-14-3-7-17(21)8-4-14/h3-11,13H,1-2H3/b16-11- |
| InChIKey | GYSARIQATCAJMA-WJDWOHSUSA-N |
| XLogP | 4.78 |
| TPSA | 74.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.95 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|