C18H9ClN3O3S- — CID 7121362
4-[2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-cyanoethenyl]-2-nitrophenolate (PubChem CID 7121362) has the molecular formula C18H9ClN3O3S- and a molecular weight of 382.81 g/mol. Its IUPAC name is 4-[2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-cyanoethenyl]-2-nitrophenolate.
| Compound Name | 4-[2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-cyanoethenyl]-2-nitrophenolate |
|---|---|
| PubChem CID | 7121362 |
| Molecular Formula | C18H9ClN3O3S- |
| Molecular Weight | 382.81 g/mol |
| Exact Mass | 382.01 |
| IUPAC Name | 4-[2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-cyanoethenyl]-2-nitrophenolate |
| SMILES | N#CC(=Cc1ccc([O-])c([N+](=O)[O-])c1)c1nc(-c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C18H10ClN3O3S/c19-14-4-2-12(3-5-14)15-10-26-18(21-15)13(9-20)7-11-1-6-17(23)16(8-11)22(24)25/h1-8,10,23H/p-1 |
| InChIKey | FRLHPQFGRNXFLL-UHFFFAOYSA-M |
| XLogP | 4.51 |
| TPSA | 102.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.81 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|