C18H9Cl2N3O2S — CID 4255074
2-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-3-(3-nitrophenyl)prop-2-enenitrile (PubChem CID 4255074) has the molecular formula C18H9Cl2N3O2S and a molecular weight of 402.26 g/mol. Its IUPAC name is 2-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-3-(3-nitrophenyl)prop-2-enenitrile.
| Compound Name | 2-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-3-(3-nitrophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 4255074 |
| Molecular Formula | C18H9Cl2N3O2S |
| Molecular Weight | 402.26 g/mol |
| Exact Mass | 400.98 |
| IUPAC Name | 2-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-3-(3-nitrophenyl)prop-2-enenitrile |
| SMILES | N#CC(=Cc1cccc([N+](=O)[O-])c1)c1nc(-c2ccc(Cl)c(Cl)c2)cs1 |
| InChI | InChI=1S/C18H9Cl2N3O2S/c19-15-5-4-12(8-16(15)20)17-10-26-18(22-17)13(9-21)6-11-2-1-3-14(7-11)23(24)25/h1-8,10H |
| InChIKey | MGPLJHCCOLGCPC-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 79.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.26 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|