C18H10BrN3O3S — CID 135470826
(E)-3-(3-bromo-4-hydroxyphenyl)-2-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 135470826) has the molecular formula C18H10BrN3O3S and a molecular weight of 428.27 g/mol. Its IUPAC name is (E)-3-(3-bromo-4-hydroxyphenyl)-2-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | (E)-3-(3-bromo-4-hydroxyphenyl)-2-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 135470826 |
| Molecular Formula | C18H10BrN3O3S |
| Molecular Weight | 428.27 g/mol |
| Exact Mass | 426.96 |
| IUPAC Name | (E)-3-(3-bromo-4-hydroxyphenyl)-2-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(O)c(Br)c1)c1nc(-c2cccc([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C18H10BrN3O3S/c19-15-7-11(4-5-17(15)23)6-13(9-20)18-21-16(10-26-18)12-2-1-3-14(8-12)22(24)25/h1-8,10,23H/b13-6+ |
| InChIKey | FEWCJKQCPXTUJL-AWNIVKPZSA-N |
| XLogP | 5.25 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.27 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|