C20H13N3O4S — CID 7448344
[4-[(Z)-2-cyano-2-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]ethenyl]phenyl] acetate (PubChem CID 7448344) has the molecular formula C20H13N3O4S and a molecular weight of 391.41 g/mol. Its IUPAC name is [4-[(Z)-2-cyano-2-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]ethenyl]phenyl] acetate.
| Compound Name | [4-[(Z)-2-cyano-2-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]ethenyl]phenyl] acetate |
|---|---|
| PubChem CID | 7448344 |
| Molecular Formula | C20H13N3O4S |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | [4-[(Z)-2-cyano-2-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]ethenyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(/C=C(/C#N)c2nc(-c3cccc([N+](=O)[O-])c3)cs2)cc1 |
| InChI | InChI=1S/C20H13N3O4S/c1-13(24)27-18-7-5-14(6-8-18)9-16(11-21)20-22-19(12-28-20)15-3-2-4-17(10-15)23(25)26/h2-10,12H,1H3/b16-9- |
| InChIKey | JZEQDCPTXWJVDB-SXGWCWSVSA-N |
| XLogP | 4.71 |
| TPSA | 106.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|