C25H17N3O3S — CID 2856470
2-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-3-(3-phenylmethoxyphenyl)prop-2-enenitrile (PubChem CID 2856470) has the molecular formula C25H17N3O3S and a molecular weight of 439.50 g/mol. Its IUPAC name is 2-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-3-(3-phenylmethoxyphenyl)prop-2-enenitrile.
| Compound Name | 2-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-3-(3-phenylmethoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 2856470 |
| Molecular Formula | C25H17N3O3S |
| Molecular Weight | 439.50 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | 2-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-3-(3-phenylmethoxyphenyl)prop-2-enenitrile |
| SMILES | N#CC(=Cc1cccc(OCc2ccccc2)c1)c1nc(-c2cccc([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C25H17N3O3S/c26-15-21(25-27-24(17-32-25)20-9-5-10-22(14-20)28(29)30)12-19-8-4-11-23(13-19)31-16-18-6-2-1-3-7-18/h1-14,17H,16H2 |
| InChIKey | VUCLBTFAAUSCSP-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 89.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.50 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|