C31H22N2OS — CID 2848969
3-(4-phenylmethoxyphenyl)-2-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 2848969) has the molecular formula C31H22N2OS and a molecular weight of 470.60 g/mol. Its IUPAC name is 3-(4-phenylmethoxyphenyl)-2-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | 3-(4-phenylmethoxyphenyl)-2-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 2848969 |
| Molecular Formula | C31H22N2OS |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 3-(4-phenylmethoxyphenyl)-2-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccc(OCc2ccccc2)cc1)c1nc(-c2ccc(-c3ccccc3)cc2)cs1 |
| InChI | InChI=1S/C31H22N2OS/c32-20-28(19-23-11-17-29(18-12-23)34-21-24-7-3-1-4-8-24)31-33-30(22-35-31)27-15-13-26(14-16-27)25-9-5-2-6-10-25/h1-19,22H,21H2 |
| InChIKey | YVONVNKHLZZKCV-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|