C17H11N3S — CID 75409758
(Z)-2-(4-phenyl-1,3-thiazol-2-yl)-3-pyridin-4-ylprop-2-enenitrile (PubChem CID 75409758) has the molecular formula C17H11N3S and a molecular weight of 289.36 g/mol. Its IUPAC name is (Z)-2-(4-phenyl-1,3-thiazol-2-yl)-3-pyridin-4-ylprop-2-enenitrile.
| Compound Name | (Z)-2-(4-phenyl-1,3-thiazol-2-yl)-3-pyridin-4-ylprop-2-enenitrile |
|---|---|
| PubChem CID | 75409758 |
| Molecular Formula | C17H11N3S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | (Z)-2-(4-phenyl-1,3-thiazol-2-yl)-3-pyridin-4-ylprop-2-enenitrile |
| SMILES | N#C/C(=C/c1ccncc1)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C17H11N3S/c18-11-15(10-13-6-8-19-9-7-13)17-20-16(12-21-17)14-4-2-1-3-5-14/h1-10,12H/b15-10- |
| InChIKey | IVDNLJUPXUXJSL-GDNBJRDFSA-N |
| XLogP | 4.27 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|