C21H15N5S — CID 47498353
(Z)-3-(1-benzylpyrazol-4-yl)-2-(4-pyridin-4-yl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 47498353) has the molecular formula C21H15N5S and a molecular weight of 369.45 g/mol. Its IUPAC name is (Z)-3-(1-benzylpyrazol-4-yl)-2-(4-pyridin-4-yl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (Z)-3-(1-benzylpyrazol-4-yl)-2-(4-pyridin-4-yl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 47498353 |
| Molecular Formula | C21H15N5S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | (Z)-3-(1-benzylpyrazol-4-yl)-2-(4-pyridin-4-yl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C/c1cnn(Cc2ccccc2)c1)c1nc(-c2ccncc2)cs1 |
| InChI | InChI=1S/C21H15N5S/c22-11-19(21-25-20(15-27-21)18-6-8-23-9-7-18)10-17-12-24-26(14-17)13-16-4-2-1-3-5-16/h1-10,12,14-15H,13H2/b19-10- |
| InChIKey | AKEYLHVQKMDDQH-GRSHGNNSSA-N |
| XLogP | 4.51 |
| TPSA | 67.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|