C21H13ClN4S — CID 27394978
(E)-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-(1-phenylpyrazol-4-yl)prop-2-enenitrile (PubChem CID 27394978) has the molecular formula C21H13ClN4S and a molecular weight of 388.88 g/mol. Its IUPAC name is (E)-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-(1-phenylpyrazol-4-yl)prop-2-enenitrile.
| Compound Name | (E)-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-(1-phenylpyrazol-4-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 27394978 |
| Molecular Formula | C21H13ClN4S |
| Molecular Weight | 388.88 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | (E)-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-(1-phenylpyrazol-4-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1cnn(-c2ccccc2)c1)c1nc(-c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C21H13ClN4S/c22-18-8-6-16(7-9-18)20-14-27-21(25-20)17(11-23)10-15-12-24-26(13-15)19-4-2-1-3-5-19/h1-10,12-14H/b17-10+ |
| InChIKey | PAVPLKJRNLYIMK-LICLKQGHSA-N |
| XLogP | 5.71 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.88 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|