C19H14N2OS — CID 4288930
3-(4-methoxyphenyl)-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 4288930) has the molecular formula C19H14N2OS and a molecular weight of 318.40 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | 3-(4-methoxyphenyl)-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 4288930 |
| Molecular Formula | C19H14N2OS |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 3-(4-methoxyphenyl)-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | COc1ccc(C=C(C#N)c2nc(-c3ccccc3)cs2)cc1 |
| InChI | InChI=1S/C19H14N2OS/c1-22-17-9-7-14(8-10-17)11-16(12-20)19-21-18(13-23-19)15-5-3-2-4-6-15/h2-11,13H,1H3 |
| InChIKey | CSQWWKSPWPRKIS-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|