C21H15BrN2OS — CID 2345996
(2Z,4Z)-4-bromo-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-5-phenylpenta-2,4-dienenitrile (PubChem CID 2345996) has the molecular formula C21H15BrN2OS and a molecular weight of 423.34 g/mol. Its IUPAC name is (2Z,4Z)-4-bromo-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-5-phenylpenta-2,4-dienenitrile.
| Compound Name | (2Z,4Z)-4-bromo-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-5-phenylpenta-2,4-dienenitrile |
|---|---|
| PubChem CID | 2345996 |
| Molecular Formula | C21H15BrN2OS |
| Molecular Weight | 423.34 g/mol |
| Exact Mass | 422.01 |
| IUPAC Name | (2Z,4Z)-4-bromo-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-5-phenylpenta-2,4-dienenitrile |
| SMILES | COc1ccc(-c2csc(/C(C#N)=C\C(Br)=C\c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C21H15BrN2OS/c1-25-19-9-7-16(8-10-19)20-14-26-21(24-20)17(13-23)12-18(22)11-15-5-3-2-4-6-15/h2-12,14H,1H3/b17-12-,18-11- |
| InChIKey | JIKDJOFBGQVBRD-NOQBVXGDSA-N |
| XLogP | 6.16 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.34 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|