C25H18N2O2S — CID 5334014
(E)-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-3-(3-phenoxyphenyl)prop-2-enenitrile (PubChem CID 5334014) has the molecular formula C25H18N2O2S and a molecular weight of 410.50 g/mol. Its IUPAC name is (E)-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-3-(3-phenoxyphenyl)prop-2-enenitrile.
| Compound Name | (E)-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-3-(3-phenoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 5334014 |
| Molecular Formula | C25H18N2O2S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | (E)-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-3-(3-phenoxyphenyl)prop-2-enenitrile |
| SMILES | COc1ccc(-c2csc(/C(C#N)=C/c3cccc(Oc4ccccc4)c3)n2)cc1 |
| InChI | InChI=1S/C25H18N2O2S/c1-28-21-12-10-19(11-13-21)24-17-30-25(27-24)20(16-26)14-18-6-5-9-23(15-18)29-22-7-3-2-4-8-22/h2-15,17H,1H3/b20-14+ |
| InChIKey | NMVFDRIKSDZITP-XSFVSMFZSA-N |
| XLogP | 6.68 |
| TPSA | 55.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|