C20H16N2OS — CID 630432
3-(4-methoxyphenyl)-2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 630432) has the molecular formula C20H16N2OS and a molecular weight of 332.43 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | 3-(4-methoxyphenyl)-2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 630432 |
| Molecular Formula | C20H16N2OS |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 3-(4-methoxyphenyl)-2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | COc1ccc(C=C(C#N)c2nc(-c3ccc(C)cc3)cs2)cc1 |
| InChI | InChI=1S/C20H16N2OS/c1-14-3-7-16(8-4-14)19-13-24-20(22-19)17(12-21)11-15-5-9-18(23-2)10-6-15/h3-11,13H,1-2H3 |
| InChIKey | FWQNVFORVGVQKN-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|