C24H15N5S2 — CID 52747167
(Z)-3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)-2-(4-pyridin-4-yl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 52747167) has the molecular formula C24H15N5S2 and a molecular weight of 437.55 g/mol. Its IUPAC name is (Z)-3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)-2-(4-pyridin-4-yl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (Z)-3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)-2-(4-pyridin-4-yl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 52747167 |
| Molecular Formula | C24H15N5S2 |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | (Z)-3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)-2-(4-pyridin-4-yl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C/c1cn(-c2ccccc2)nc1-c1cccs1)c1nc(-c2ccncc2)cs1 |
| InChI | InChI=1S/C24H15N5S2/c25-14-18(24-27-21(16-31-24)17-8-10-26-11-9-17)13-19-15-29(20-5-2-1-3-6-20)28-23(19)22-7-4-12-30-22/h1-13,15-16H/b18-13- |
| InChIKey | LUHKAVHDKFXTLL-AQTBWJFISA-N |
| XLogP | 6.18 |
| TPSA | 67.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|