C19H13N3S2 — CID 110536012
(Z)-3-(1-methylindol-3-yl)-2-(4-thiophen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 110536012) has the molecular formula C19H13N3S2 and a molecular weight of 347.47 g/mol. Its IUPAC name is (Z)-3-(1-methylindol-3-yl)-2-(4-thiophen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (Z)-3-(1-methylindol-3-yl)-2-(4-thiophen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 110536012 |
| Molecular Formula | C19H13N3S2 |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | (Z)-3-(1-methylindol-3-yl)-2-(4-thiophen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | Cn1cc(/C=C(/C#N)c2nc(-c3cccs3)cs2)c2ccccc21 |
| InChI | InChI=1S/C19H13N3S2/c1-22-11-14(15-5-2-3-6-17(15)22)9-13(10-20)19-21-16(12-24-19)18-7-4-8-23-18/h2-9,11-12H,1H3/b13-9- |
| InChIKey | KNQJPHJZCZTOPH-LCYFTJDESA-N |
| XLogP | 5.43 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|