C16H9ClN2OS2 — CID 136822109
(Z)-3-(3-chloro-4-hydroxyphenyl)-2-(4-thiophen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 136822109) has the molecular formula C16H9ClN2OS2 and a molecular weight of 344.85 g/mol. Its IUPAC name is (Z)-3-(3-chloro-4-hydroxyphenyl)-2-(4-thiophen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (Z)-3-(3-chloro-4-hydroxyphenyl)-2-(4-thiophen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 136822109 |
| Molecular Formula | C16H9ClN2OS2 |
| Molecular Weight | 344.85 g/mol |
| Exact Mass | 343.98 |
| IUPAC Name | (Z)-3-(3-chloro-4-hydroxyphenyl)-2-(4-thiophen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C/c1ccc(O)c(Cl)c1)c1nc(-c2cccs2)cs1 |
| InChI | InChI=1S/C16H9ClN2OS2/c17-12-7-10(3-4-14(12)20)6-11(8-18)16-19-13(9-22-16)15-2-1-5-21-15/h1-7,9,20H/b11-6- |
| InChIKey | DCSAMANYBIISQK-WDZFZDKYSA-N |
| XLogP | 5.29 |
| TPSA | 56.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.85 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|