C19H16N2O2S2 — CID 112538626
(Z)-3-(3-ethoxy-4-methoxyphenyl)-2-(4-thiophen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 112538626) has the molecular formula C19H16N2O2S2 and a molecular weight of 368.48 g/mol. Its IUPAC name is (Z)-3-(3-ethoxy-4-methoxyphenyl)-2-(4-thiophen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (Z)-3-(3-ethoxy-4-methoxyphenyl)-2-(4-thiophen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 112538626 |
| Molecular Formula | C19H16N2O2S2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | (Z)-3-(3-ethoxy-4-methoxyphenyl)-2-(4-thiophen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | CCOc1cc(/C=C(/C#N)c2nc(-c3cccs3)cs2)ccc1OC |
| InChI | InChI=1S/C19H16N2O2S2/c1-3-23-17-10-13(6-7-16(17)22-2)9-14(11-20)19-21-15(12-25-19)18-5-4-8-24-18/h4-10,12H,3H2,1-2H3/b14-9- |
| InChIKey | BTPQLYRNGUPLPV-ZROIWOOFSA-N |
| XLogP | 5.34 |
| TPSA | 55.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|