C18H15N3O3S — CID 9212650
(E)-3-(4-ethoxy-3-methoxyphenyl)-2-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)prop-2-enenitrile (PubChem CID 9212650) has the molecular formula C18H15N3O3S and a molecular weight of 353.40 g/mol. Its IUPAC name is (E)-3-(4-ethoxy-3-methoxyphenyl)-2-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)prop-2-enenitrile.
| Compound Name | (E)-3-(4-ethoxy-3-methoxyphenyl)-2-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 9212650 |
| Molecular Formula | C18H15N3O3S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | (E)-3-(4-ethoxy-3-methoxyphenyl)-2-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)prop-2-enenitrile |
| SMILES | CCOc1ccc(/C=C(\C#N)c2nc(-c3cccs3)no2)cc1OC |
| InChI | InChI=1S/C18H15N3O3S/c1-3-23-14-7-6-12(10-15(14)22-2)9-13(11-19)18-20-17(21-24-18)16-5-4-8-25-16/h4-10H,3H2,1-2H3/b13-9+ |
| InChIKey | CJAWOBPINAMKOI-UKTHLTGXSA-N |
| XLogP | 4.27 |
| TPSA | 81.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|