C20H22N4O5S — CID 16764750
N-[2-[(3,4-diethoxybenzoyl)amino]ethyl]-3-thiophen-2-yl-1,2,4-oxadiazole-5-carboxamide (PubChem CID 16764750) has the molecular formula C20H22N4O5S and a molecular weight of 430.49 g/mol. Its IUPAC name is N-[2-[(3,4-diethoxybenzoyl)amino]ethyl]-3-thiophen-2-yl-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | N-[2-[(3,4-diethoxybenzoyl)amino]ethyl]-3-thiophen-2-yl-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 16764750 |
| Molecular Formula | C20H22N4O5S |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | N-[2-[(3,4-diethoxybenzoyl)amino]ethyl]-3-thiophen-2-yl-1,2,4-oxadiazole-5-carboxamide |
| SMILES | CCOc1ccc(C(=O)NCCNC(=O)c2nc(-c3cccs3)no2)cc1OCC |
| InChI | InChI=1S/C20H22N4O5S/c1-3-27-14-8-7-13(12-15(14)28-4-2)18(25)21-9-10-22-19(26)20-23-17(24-29-20)16-6-5-11-30-16/h5-8,11-12H,3-4,9-10H2,1-2H3,(H,21,25)(H,22,26) |
| InChIKey | NGQDSILDPNNYLA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 115.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|