C20H22N4O3S — CID 17083296
N-[2-[(4-tert-butylbenzoyl)amino]ethyl]-3-thiophen-2-yl-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17083296) has the molecular formula C20H22N4O3S and a molecular weight of 398.49 g/mol. Its IUPAC name is N-[2-[(4-tert-butylbenzoyl)amino]ethyl]-3-thiophen-2-yl-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | N-[2-[(4-tert-butylbenzoyl)amino]ethyl]-3-thiophen-2-yl-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17083296 |
| Molecular Formula | C20H22N4O3S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | N-[2-[(4-tert-butylbenzoyl)amino]ethyl]-3-thiophen-2-yl-1,2,4-oxadiazole-5-carboxamide |
| SMILES | CC(C)(C)c1ccc(C(=O)NCCNC(=O)c2nc(-c3cccs3)no2)cc1 |
| InChI | InChI=1S/C20H22N4O3S/c1-20(2,3)14-8-6-13(7-9-14)17(25)21-10-11-22-18(26)19-23-16(24-27-19)15-5-4-12-28-15/h4-9,12H,10-11H2,1-3H3,(H,21,25)(H,22,26) |
| InChIKey | RMZASYLQAPPUIF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|