3-thiophen-2-yl-1,2,4-oxadiazole-5-carboxylic acid

C7H4N2O3S — CID 28806054

IUPAC3-thiophen-2-yl-1,2,4-oxadiazole-5-carboxylic acid
SMILESO=C(O)c1nc(-c2cccs2)no1
InChIInChI=1S/C7H4N2O3S/c10-7(11)6-8-5(9-12-6)4-2-1-3-13-4/h1-3H,(H,10,11)
InChIKeySNYYHZDGLWGPIJ-UHFFFAOYSA-N
MW196.19 g/mol
LogP1.50
Rot. Bonds2

About 3-thiophen-2-yl-1,2,4-oxadiazole-5-carboxylic acid

3-thiophen-2-yl-1,2,4-oxadiazole-5-carboxylic acid (PubChem CID 28806054) has the molecular formula C7H4N2O3S and a molecular weight of 196.19 g/mol. Its IUPAC name is 3-thiophen-2-yl-1,2,4-oxadiazole-5-carboxylic acid.

Molecular Properties

Compound Name3-thiophen-2-yl-1,2,4-oxadiazole-5-carboxylic acid
PubChem CID28806054
Molecular FormulaC7H4N2O3S
Molecular Weight196.19 g/mol
Exact Mass195.99
IUPAC Name3-thiophen-2-yl-1,2,4-oxadiazole-5-carboxylic acid
SMILESO=C(O)c1nc(-c2cccs2)no1
InChIInChI=1S/C7H4N2O3S/c10-7(11)6-8-5(9-12-6)4-2-1-3-13-4/h1-3H,(H,10,11)
InChIKeySNYYHZDGLWGPIJ-UHFFFAOYSA-N
XLogP1.50
TPSA76.22 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.19
LogP ≤ 51.50
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 3-thiophen-2-yl-1,2,4-oxadiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-thiophen-2-yl-1,2,4-oxadiazole-5-carboxylic acid?
The IUPAC name of 3-thiophen-2-yl-1,2,4-oxadiazole-5-carboxylic acid (CID 28806054) is 3-thiophen-2-yl-1,2,4-oxadiazole-5-carboxylic acid.
What is the SMILES notation for 3-thiophen-2-yl-1,2,4-oxadiazole-5-carboxylic acid?
The canonical SMILES for 3-thiophen-2-yl-1,2,4-oxadiazole-5-carboxylic acid is O=C(O)c1nc(-c2cccs2)no1.
What is the InChIKey of 3-thiophen-2-yl-1,2,4-oxadiazole-5-carboxylic acid?
The InChIKey is SNYYHZDGLWGPIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N2O3S/c10-7(11)6-8-5(9-12-6)4-2-1-3-13-4/h1-3H,(H,10,11).
What are the key properties of 3-thiophen-2-yl-1,2,4-oxadiazole-5-carboxylic acid?
3-thiophen-2-yl-1,2,4-oxadiazole-5-carboxylic acid has a molecular weight of 196.19 g/mol, XLogP of 1.50, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-thiophen-2-yl-1,2,4-oxadiazole-5-carboxylic acid is sourced from PubChem (CID 28806054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).