C7H4N2O3S — CID 28806054
3-thiophen-2-yl-1,2,4-oxadiazole-5-carboxylic acid (PubChem CID 28806054) has the molecular formula C7H4N2O3S and a molecular weight of 196.19 g/mol. Its IUPAC name is 3-thiophen-2-yl-1,2,4-oxadiazole-5-carboxylic acid.
| Compound Name | 3-thiophen-2-yl-1,2,4-oxadiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 28806054 |
| Molecular Formula | C7H4N2O3S |
| Molecular Weight | 196.19 g/mol |
| Exact Mass | 195.99 |
| IUPAC Name | 3-thiophen-2-yl-1,2,4-oxadiazole-5-carboxylic acid |
| SMILES | O=C(O)c1nc(-c2cccs2)no1 |
| InChI | InChI=1S/C7H4N2O3S/c10-7(11)6-8-5(9-12-6)4-2-1-3-13-4/h1-3H,(H,10,11) |
| InChIKey | SNYYHZDGLWGPIJ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.19 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |