C22H30N4O5 — CID 17083421
3-cyclohexyl-N-[2-[(3,4-diethoxybenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17083421) has the molecular formula C22H30N4O5 and a molecular weight of 430.51 g/mol. Its IUPAC name is 3-cyclohexyl-N-[2-[(3,4-diethoxybenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-cyclohexyl-N-[2-[(3,4-diethoxybenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17083421 |
| Molecular Formula | C22H30N4O5 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | 3-cyclohexyl-N-[2-[(3,4-diethoxybenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | CCOc1ccc(C(=O)NCCNC(=O)c2nc(C3CCCCC3)no2)cc1OCC |
| InChI | InChI=1S/C22H30N4O5/c1-3-29-17-11-10-16(14-18(17)30-4-2)20(27)23-12-13-24-21(28)22-25-19(26-31-22)15-8-6-5-7-9-15/h10-11,14-15H,3-9,12-13H2,1-2H3,(H,23,27)(H,24,28) |
| InChIKey | UMMJQSQHELTXGY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 115.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|