C18H15N3O4S — CID 9212728
(E)-2-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)-3-(2,4,5-trimethoxyphenyl)prop-2-enenitrile (PubChem CID 9212728) has the molecular formula C18H15N3O4S and a molecular weight of 369.40 g/mol. Its IUPAC name is (E)-2-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)-3-(2,4,5-trimethoxyphenyl)prop-2-enenitrile.
| Compound Name | (E)-2-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)-3-(2,4,5-trimethoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 9212728 |
| Molecular Formula | C18H15N3O4S |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | (E)-2-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)-3-(2,4,5-trimethoxyphenyl)prop-2-enenitrile |
| SMILES | COc1cc(OC)c(OC)cc1/C=C(\C#N)c1nc(-c2cccs2)no1 |
| InChI | InChI=1S/C18H15N3O4S/c1-22-13-9-15(24-3)14(23-2)8-11(13)7-12(10-19)18-20-17(21-25-18)16-5-4-6-26-16/h4-9H,1-3H3/b12-7+ |
| InChIKey | YLHYRDJXEZMJOS-KPKJPENVSA-N |
| XLogP | 3.89 |
| TPSA | 90.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|