C17H13N3O2S — CID 135577077
(E)-3-(4-hydroxy-3,5-dimethylphenyl)-2-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)prop-2-enenitrile (PubChem CID 135577077) has the molecular formula C17H13N3O2S and a molecular weight of 323.38 g/mol. Its IUPAC name is (E)-3-(4-hydroxy-3,5-dimethylphenyl)-2-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)prop-2-enenitrile.
| Compound Name | (E)-3-(4-hydroxy-3,5-dimethylphenyl)-2-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 135577077 |
| Molecular Formula | C17H13N3O2S |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | (E)-3-(4-hydroxy-3,5-dimethylphenyl)-2-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)prop-2-enenitrile |
| SMILES | Cc1cc(/C=C(\C#N)c2nc(-c3cccs3)no2)cc(C)c1O |
| InChI | InChI=1S/C17H13N3O2S/c1-10-6-12(7-11(2)15(10)21)8-13(9-18)17-19-16(20-22-17)14-4-3-5-23-14/h3-8,21H,1-2H3/b13-8+ |
| InChIKey | YTRVTNQWCVSPTH-MDWZMJQESA-N |
| XLogP | 4.18 |
| TPSA | 82.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|