C15H9N3O2S — CID 135577056
(E)-3-(4-hydroxyphenyl)-2-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)prop-2-enenitrile (PubChem CID 135577056) has the molecular formula C15H9N3O2S and a molecular weight of 295.32 g/mol. Its IUPAC name is (E)-3-(4-hydroxyphenyl)-2-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)prop-2-enenitrile.
| Compound Name | (E)-3-(4-hydroxyphenyl)-2-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 135577056 |
| Molecular Formula | C15H9N3O2S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | (E)-3-(4-hydroxyphenyl)-2-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(O)cc1)c1nc(-c2cccs2)no1 |
| InChI | InChI=1S/C15H9N3O2S/c16-9-11(8-10-3-5-12(19)6-4-10)15-17-14(18-20-15)13-2-1-7-21-13/h1-8,19H/b11-8+ |
| InChIKey | OENQIZFVZCUTAC-DHZHZOJOSA-N |
| XLogP | 3.57 |
| TPSA | 82.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|