C21H20N2O2S2 — CID 18864240
(E)-3-(3-butoxy-4-methoxyphenyl)-2-(4-thiophen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 18864240) has the molecular formula C21H20N2O2S2 and a molecular weight of 396.54 g/mol. Its IUPAC name is (E)-3-(3-butoxy-4-methoxyphenyl)-2-(4-thiophen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-(3-butoxy-4-methoxyphenyl)-2-(4-thiophen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 18864240 |
| Molecular Formula | C21H20N2O2S2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | (E)-3-(3-butoxy-4-methoxyphenyl)-2-(4-thiophen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | CCCCOc1cc(/C=C(\C#N)c2nc(-c3cccs3)cs2)ccc1OC |
| InChI | InChI=1S/C21H20N2O2S2/c1-3-4-9-25-19-12-15(7-8-18(19)24-2)11-16(13-22)21-23-17(14-27-21)20-6-5-10-26-20/h5-8,10-12,14H,3-4,9H2,1-2H3/b16-11+ |
| InChIKey | NEFDWNQRCBSDGM-LFIBNONCSA-N |
| XLogP | 6.12 |
| TPSA | 55.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|