C21H17FN2O2S — CID 18864221
(E)-3-(3-ethoxy-4-methoxyphenyl)-2-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 18864221) has the molecular formula C21H17FN2O2S and a molecular weight of 380.44 g/mol. Its IUPAC name is (E)-3-(3-ethoxy-4-methoxyphenyl)-2-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | (E)-3-(3-ethoxy-4-methoxyphenyl)-2-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 18864221 |
| Molecular Formula | C21H17FN2O2S |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | (E)-3-(3-ethoxy-4-methoxyphenyl)-2-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | CCOc1cc(/C=C(\C#N)c2nc(-c3ccc(F)cc3)cs2)ccc1OC |
| InChI | InChI=1S/C21H17FN2O2S/c1-3-26-20-11-14(4-9-19(20)25-2)10-16(12-23)21-24-18(13-27-21)15-5-7-17(22)8-6-15/h4-11,13H,3H2,1-2H3/b16-10+ |
| InChIKey | RLOSHHHLPWYCBI-MHWRWJLKSA-N |
| XLogP | 5.42 |
| TPSA | 55.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|