C22H21N3O3S — CID 3787387
2-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-(4-ethoxyanilino)prop-2-enenitrile (PubChem CID 3787387) has the molecular formula C22H21N3O3S and a molecular weight of 407.50 g/mol. Its IUPAC name is 2-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-(4-ethoxyanilino)prop-2-enenitrile.
| Compound Name | 2-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-(4-ethoxyanilino)prop-2-enenitrile |
|---|---|
| PubChem CID | 3787387 |
| Molecular Formula | C22H21N3O3S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 2-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-(4-ethoxyanilino)prop-2-enenitrile |
| SMILES | CCOc1ccc(NC=C(C#N)c2nc(-c3ccc(OC)c(OC)c3)cs2)cc1 |
| InChI | InChI=1S/C22H21N3O3S/c1-4-28-18-8-6-17(7-9-18)24-13-16(12-23)22-25-19(14-29-22)15-5-10-20(26-2)21(11-15)27-3/h5-11,13-14,24H,4H2,1-3H3 |
| InChIKey | WSEWJDIKKILLMT-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 76.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|