C22H21N3O2S — CID 1358230
(E)-2-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-(3,4-dimethylanilino)prop-2-enenitrile (PubChem CID 1358230) has the molecular formula C22H21N3O2S and a molecular weight of 391.50 g/mol. Its IUPAC name is (E)-2-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-(3,4-dimethylanilino)prop-2-enenitrile.
| Compound Name | (E)-2-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-(3,4-dimethylanilino)prop-2-enenitrile |
|---|---|
| PubChem CID | 1358230 |
| Molecular Formula | C22H21N3O2S |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | (E)-2-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-(3,4-dimethylanilino)prop-2-enenitrile |
| SMILES | COc1ccc(-c2csc(/C(C#N)=C/Nc3ccc(C)c(C)c3)n2)cc1OC |
| InChI | InChI=1S/C22H21N3O2S/c1-14-5-7-18(9-15(14)2)24-12-17(11-23)22-25-19(13-28-22)16-6-8-20(26-3)21(10-16)27-4/h5-10,12-13,24H,1-4H3/b17-12+ |
| InChIKey | JOLCSLUGFXYCMT-SFQUDFHCSA-N |
| XLogP | 5.42 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|