C19H15N3OS — CID 2057598
(Z)-3-(4-methoxyanilino)-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 2057598) has the molecular formula C19H15N3OS and a molecular weight of 333.42 g/mol. Its IUPAC name is (Z)-3-(4-methoxyanilino)-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (Z)-3-(4-methoxyanilino)-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 2057598 |
| Molecular Formula | C19H15N3OS |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | (Z)-3-(4-methoxyanilino)-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | COc1ccc(N/C=C(/C#N)c2nc(-c3ccccc3)cs2)cc1 |
| InChI | InChI=1S/C19H15N3OS/c1-23-17-9-7-16(8-10-17)21-12-15(11-20)19-22-18(13-24-19)14-5-3-2-4-6-14/h2-10,12-13,21H,1H3/b15-12- |
| InChIKey | GUBFNGOMDBFDIC-QINSGFPZSA-N |
| XLogP | 4.80 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|