C17H13N3OS2 — CID 3873006
3-(4-methoxyanilino)-2-(4-thiophen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 3873006) has the molecular formula C17H13N3OS2 and a molecular weight of 339.45 g/mol. Its IUPAC name is 3-(4-methoxyanilino)-2-(4-thiophen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | 3-(4-methoxyanilino)-2-(4-thiophen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3873006 |
| Molecular Formula | C17H13N3OS2 |
| Molecular Weight | 339.45 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | 3-(4-methoxyanilino)-2-(4-thiophen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | COc1ccc(NC=C(C#N)c2nc(-c3cccs3)cs2)cc1 |
| InChI | InChI=1S/C17H13N3OS2/c1-21-14-6-4-13(5-7-14)19-10-12(9-18)17-20-15(11-23-17)16-3-2-8-22-16/h2-8,10-11,19H,1H3 |
| InChIKey | OQIVMGRYVPWNRO-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.45 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|