C20H12ClN3OS2 — CID 2840699
3-(2-chloro-6-methoxyquinolin-3-yl)-2-(4-thiophen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 2840699) has the molecular formula C20H12ClN3OS2 and a molecular weight of 409.92 g/mol. Its IUPAC name is 3-(2-chloro-6-methoxyquinolin-3-yl)-2-(4-thiophen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | 3-(2-chloro-6-methoxyquinolin-3-yl)-2-(4-thiophen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 2840699 |
| Molecular Formula | C20H12ClN3OS2 |
| Molecular Weight | 409.92 g/mol |
| Exact Mass | 409.01 |
| IUPAC Name | 3-(2-chloro-6-methoxyquinolin-3-yl)-2-(4-thiophen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | COc1ccc2nc(Cl)c(C=C(C#N)c3nc(-c4cccs4)cs3)cc2c1 |
| InChI | InChI=1S/C20H12ClN3OS2/c1-25-15-4-5-16-12(9-15)7-13(19(21)23-16)8-14(10-22)20-24-17(11-27-20)18-3-2-6-26-18/h2-9,11H,1H3 |
| InChIKey | XFDVPXZUYDMNIJ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 58.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.92 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|