C19H15ClN2O2S2 — CID 110532290
(Z)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)-2-(4-thiophen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 110532290) has the molecular formula C19H15ClN2O2S2 and a molecular weight of 402.93 g/mol. Its IUPAC name is (Z)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)-2-(4-thiophen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (Z)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)-2-(4-thiophen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 110532290 |
| Molecular Formula | C19H15ClN2O2S2 |
| Molecular Weight | 402.93 g/mol |
| Exact Mass | 402.03 |
| IUPAC Name | (Z)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)-2-(4-thiophen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | CCOc1c(Cl)cc(/C=C(/C#N)c2nc(-c3cccs3)cs2)cc1OC |
| InChI | InChI=1S/C19H15ClN2O2S2/c1-3-24-18-14(20)8-12(9-16(18)23-2)7-13(10-21)19-22-15(11-26-19)17-5-4-6-25-17/h4-9,11H,3H2,1-2H3/b13-7- |
| InChIKey | KUPKTSYLHMUQCC-QPEQYQDCSA-N |
| XLogP | 6.00 |
| TPSA | 55.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.93 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|