C17H17ClN2O2S — CID 9342423
(E)-3-(3-chloro-5-methoxy-4-propoxyphenyl)-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 9342423) has the molecular formula C17H17ClN2O2S and a molecular weight of 348.86 g/mol. Its IUPAC name is (E)-3-(3-chloro-5-methoxy-4-propoxyphenyl)-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-(3-chloro-5-methoxy-4-propoxyphenyl)-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 9342423 |
| Molecular Formula | C17H17ClN2O2S |
| Molecular Weight | 348.86 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | (E)-3-(3-chloro-5-methoxy-4-propoxyphenyl)-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | CCCOc1c(Cl)cc(/C=C(\C#N)c2nc(C)cs2)cc1OC |
| InChI | InChI=1S/C17H17ClN2O2S/c1-4-5-22-16-14(18)7-12(8-15(16)21-3)6-13(9-19)17-20-11(2)10-23-17/h6-8,10H,4-5H2,1-3H3/b13-6+ |
| InChIKey | HFBOFNCOJBYNHJ-AWNIVKPZSA-N |
| XLogP | 4.97 |
| TPSA | 55.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.86 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|